CAS 1086393-08-9
:5-Phenyl-3-pyrrolidinecarboxylic acid
Description:
5-Phenyl-3-pyrrolidinecarboxylic acid is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a phenyl group at the 5-position and a carboxylic acid functional group at the 3-position contributes to its unique properties. This compound is likely to exhibit both hydrophilic and hydrophobic characteristics due to the polar carboxylic acid group and the nonpolar phenyl group. It may participate in various chemical reactions typical of carboxylic acids, such as esterification and amidation. Additionally, the nitrogen atom in the pyrrolidine ring can engage in hydrogen bonding, influencing its solubility and reactivity. The compound's potential applications could span medicinal chemistry, where it may serve as a building block for pharmaceuticals or as a ligand in coordination chemistry. However, specific biological activities, toxicity, and environmental impact would require further investigation through empirical studies.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c13-11(14)9-6-10(12-7-9)8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2,(H,13,14)
InChI key:InChIKey=ZOLFKBOSDHKUFU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CC(NC1)C2=CC=CC=C2
Synonyms:- 5-Phenyl-3-pyrrolidinecarboxylic acid
- 3-Pyrrolidinecarboxylic acid, 5-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
