CAS 1086393-21-6
:Ethyl 5-bromo-4-(trifluoromethyl)-2-thiazolecarboxylate
Description:
Ethyl 5-bromo-4-(trifluoromethyl)-2-thiazolecarboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. The presence of a bromine atom at the 5-position and a trifluoromethyl group at the 4-position contributes to its unique reactivity and physical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in various synthetic applications, particularly in medicinal chemistry and agrochemicals. The ethyl ester functional group enhances its reactivity, allowing for further chemical modifications. Additionally, the trifluoromethyl group is known to impart significant biological activity and lipophilicity, making this compound of interest in drug design. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, Ethyl 5-bromo-4-(trifluoromethyl)-2-thiazolecarboxylate is a versatile intermediate in organic synthesis.
Formula:C7H5BrF3NO2S
InChI:InChI=1S/C7H5BrF3NO2S/c1-2-14-6(13)5-12-3(4(8)15-5)7(9,10)11/h2H2,1H3
InChI key:InChIKey=WSXOXAAWKVQORZ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N=C(C(OCC)=O)SC1Br
Synonyms:- Ethyl 5-bromo-4-(trifluoromethyl)-2-thiazolecarboxylate
- 2-Thiazolecarboxylic acid, 5-bromo-4-(trifluoromethyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ethyl 5-bromo-4-(trifluoromethyl)thiazole-2-carboxylate
CAS:Formula:C7H5BrF3NO2SMolecular weight:304.0843Ethyl 5-bromo-4-(trifluoromethyl)-1,3-thiazole-2-carboxylate
CAS:Ethyl 5-bromo-4-(trifluoromethyl)-1,3-thiazole-2-carboxylate
Molecular weight:304.08431g/mol


