
CAS 1086393-22-7
:N-Cyclopropyl-1,2,4-triazin-3-amine
Description:
N-Cyclopropyl-1,2,4-triazin-3-amine is a chemical compound characterized by its unique triazine ring structure, which incorporates a cyclopropyl group. This compound features a triazine moiety, consisting of three nitrogen atoms and three carbon atoms arranged in a six-membered ring, with an amine functional group attached at the 3-position. The presence of the cyclopropyl group contributes to its distinct steric and electronic properties, potentially influencing its reactivity and interactions with biological targets. N-Cyclopropyl-1,2,4-triazin-3-amine may exhibit interesting pharmacological activities, making it a subject of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Understanding its characteristics is essential for exploring its potential applications in pharmaceuticals or agrochemicals.
Formula:C6H8N4
InChI:InChI=1S/C6H8N4/c1-2-5(1)9-6-7-3-4-8-10-6/h3-5H,1-2H2,(H,7,9,10)
InChI key:InChIKey=UUBDQOPXLDAQCU-UHFFFAOYSA-N
SMILES:N(C=1N=CC=NN1)C2CC2
Synonyms:- 1,2,4-Triazin-3-amine, N-cyclopropyl-
- N-Cyclopropyl-1,2,4-triazin-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.