CAS 1086393-39-6

2-(1-Methylethyl)-5-thiazolecarbonitrile

Description:

2-(1-Methylethyl)-5-thiazolecarbonitrile, identified by its CAS number 1086393-39-6, is a chemical compound that features a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound is characterized by the presence of a carbonitrile group (-C≡N) and an isopropyl group (1-methylethyl) attached to the thiazole ring. The thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The carbonitrile functional group can enhance the compound's reactivity and solubility in organic solvents. Additionally, the presence of the isopropyl group may influence the compound's steric properties and overall molecular stability. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature typically exhibit moderate to high polarity and may participate in various chemical reactions, including nucleophilic additions and cycloadditions. Further studies would be necessary to elucidate its complete chemical behavior and potential applications.

Formula: C₇H₈N₂S

InChI: InChI=1S/C7H8N2S/c1-5(2)7-9-4-6(3-8)10-7/h4-5H,1-2H3

InChI key: InChIKey=KGSWRJMIVDNBTI-UHFFFAOYSA-N

SMILES: C(C)(C)C=1SC(C#N)=CN1

Synonyms:

• 2-(1-Methylethyl)-5-thiazolecarbonitrile
• 5-Thiazolecarbonitrile, 2-(1-methylethyl)-