CymitQuimica logo

CAS 1086393-74-9

:

2-(4-Bromophenyl)-5-pyrimidinemethanol

Description:
2-(4-Bromophenyl)-5-pyrimidinemethanol is an organic compound characterized by its unique structure, which includes a pyrimidine ring and a bromophenyl group. The presence of the bromine atom introduces notable electronegative properties, influencing the compound's reactivity and potential interactions in various chemical environments. This compound typically exhibits moderate solubility in polar solvents due to the hydroxyl (-OH) group, which can engage in hydrogen bonding. The pyrimidine moiety contributes to its potential biological activity, as many pyrimidine derivatives are known for their roles in pharmaceuticals and agrochemicals. The compound may also display interesting optical properties, depending on its specific configuration and substituents. Its synthesis often involves multi-step reactions, including bromination and subsequent functionalization of the pyrimidine ring. Overall, 2-(4-Bromophenyl)-5-pyrimidinemethanol is of interest in medicinal chemistry and material science, where its structural features can be leveraged for developing new therapeutic agents or functional materials.
Formula:C11H9BrN2O
InChI:InChI=1S/C11H9BrN2O/c12-10-3-1-9(2-4-10)11-13-5-8(7-15)6-14-11/h1-6,15H,7H2
InChI key:InChIKey=LLMYDFJHJDNKHT-UHFFFAOYSA-N
SMILES:C(O)C=1C=NC(=NC1)C2=CC=C(Br)C=C2
Synonyms:
  • 5-Pyrimidinemethanol, 2-(4-bromophenyl)-
  • 2-(4-Bromophenyl)-5-pyrimidinemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.