CymitQuimica logo

CAS 1086393-80-7

:

2-(3-Bromophenyl)-5-pyrimidinecarbonitrile

Description:
2-(3-Bromophenyl)-5-pyrimidinecarbonitrile is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a bromophenyl group. The presence of the bromine atom on the phenyl ring enhances its reactivity and can influence its electronic properties, making it a potential candidate for various chemical reactions and applications. The carbonitrile functional group (-C≡N) contributes to the compound's polarity and can participate in nucleophilic addition reactions. This compound is typically used in medicinal chemistry and material science due to its potential biological activity and ability to form coordination complexes. Its molecular structure allows for various interactions, making it of interest in the development of pharmaceuticals and agrochemicals. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, 2-(3-Bromophenyl)-5-pyrimidinecarbonitrile is a versatile compound with significant implications in chemical research and development.
Formula:C11H6BrN3
InChI:InChI=1S/C11H6BrN3/c12-10-3-1-2-9(4-10)11-14-6-8(5-13)7-15-11/h1-4,6-7H
InChI key:InChIKey=GXWBHSKFYYEUSE-UHFFFAOYSA-N
SMILES:BrC=1C=C(C=CC1)C=2N=CC(C#N)=CN2
Synonyms:
  • 2-(3-Bromophenyl)-5-pyrimidinecarbonitrile
  • 5-Pyrimidinecarbonitrile, 2-(3-bromophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.