CymitQuimica logo

CAS 1086394-55-9

:

1,1-Dimethylethyl 2,6-diazaspiro[4.5]decane-2-carboxylate

Description:
1,1-Dimethylethyl 2,6-diazaspiro[4.5]decane-2-carboxylate, identified by its CAS number 1086394-55-9, is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen atoms and a carboxylate functional group. This compound features a spiro arrangement, indicating that it contains two rings that share a single atom, contributing to its rigidity and potential biological activity. The presence of the dimethyl group enhances its steric bulk, which can influence its reactivity and interactions with biological targets. The diaza component suggests potential for hydrogen bonding and coordination with metal ions, making it of interest in coordination chemistry and medicinal applications. Additionally, the carboxylate group may impart solubility in polar solvents and facilitate interactions with biological macromolecules. Overall, this compound's structural features suggest potential utility in pharmaceuticals or as a ligand in coordination complexes, although specific applications would depend on further research into its properties and behavior in various environments.
Formula:C13H24N2O2
InChI:InChI=1S/C13H24N2O2/c1-12(2,3)17-11(16)15-9-7-13(10-15)6-4-5-8-14-13/h14H,4-10H2,1-3H3
InChI key:InChIKey=LIBZZJJMJPLVQW-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC2(CC1)CCCCN2
Synonyms:
  • 1,1-Dimethylethyl 2,6-diazaspiro[4.5]decane-2-carboxylate
  • 2,6-Diazaspiro[4.5]decane-2-carboxylic acid,1,1-dimethylethyl ester
  • 2-Boc-2,6-Diazaspiro[4.5]Decane
  • tert-Butyl 2,6-diazaspiro[4.5]decane-2-carboxylate
Found 5 products.