CAS 1086394-57-1

1,1-Dimethylethyl 2,6-diazaspiro[3.5]nonane-2-carboxylate

Description:

1,1-Dimethylethyl 2,6-diazaspiro[3.5]nonane-2-carboxylate, identified by its CAS number 1086394-57-1, is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen atoms and a carboxylate functional group. This compound features a spiro arrangement, indicating that it contains two rings that share a single atom, contributing to its rigidity and potential biological activity. The presence of the dimethyl group enhances its steric bulk, which can influence its reactivity and interactions with biological targets. The diaza component suggests that it may exhibit properties related to nitrogen-containing heterocycles, potentially impacting its solubility and reactivity. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties. Additionally, the carboxylate group may facilitate interactions with other molecules, making it a candidate for further studies in drug development or as a synthetic intermediate. Overall, the structural features of this compound suggest a complex interplay of properties that could be explored in various chemical and biological contexts.

Formula: C₁₂H₂₂N₂O₂

InChI: InChI=1S/C12H22N2O2/c1-11(2,3)16-10(15)14-8-12(9-14)5-4-6-13-7-12/h13H,4-9H2,1-3H3

InChI key: InChIKey=ZEYUNZHFLQBWNJ-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC2(C1)CCCNC2

Synonyms:

• 1,1-Dimethylethyl 2,6-diazaspiro[3.5]nonane-2-carboxylate
• 2,6-Diazaspiro[3.5]nonane-2-carboxylic acid tert-butyl ester
• 2,6-Diazaspiro[3.5]nonane-2-carboxylic acid, 1,1-dimethylethyl ester
• 2-Boc-2,6-diazaspiro[3.5]nonane

tert-Butyl 2,6-diazaspiro[3.5]nonane-2-carboxylate

CAS: 1086394-57-1

Formula: C₁₂H₂₂N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 226.3153

Ref: IN-DA007UHD

tert-Butyl 2,6-diazaspiro[3.5]nonane-2-carboxylate

CAS: 1086394-57-1

tert-Butyl 2,6-diazaspiro[3.5]nonane-2-carboxylate

Purity: 97%

Molecular weight: 226.32g/mol

Ref: 54-OR312202

tert-Butyl 2,6-diazaspiro[3.5]nonane-2-carboxylate

CAS: 1086394-57-1

Formula: C₁₂H₂₂N₂O₂

Purity: 95%

Color and Shape: No data available.

Molecular weight: 226.32

Ref: 10-F236620