
CAS 1086394-68-4
:Phenylmethyl 2,8-diazaspiro[4.5]decane-2-carboxylate
Description:
Phenylmethyl 2,8-diazaspiro[4.5]decane-2-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which includes a bicyclic framework featuring two nitrogen atoms integrated into the spiro system. This compound typically exhibits properties associated with both amines and esters due to the presence of the diaza (two nitrogen atoms) and carboxylate functional groups. The spiro structure contributes to its rigidity and may influence its biological activity and solubility. The phenylmethyl group adds to its hydrophobic character, which can affect its interaction with biological membranes and potential pharmacological properties. As with many nitrogen-containing compounds, it may exhibit basicity and can participate in hydrogen bonding, influencing its reactivity and stability. The specific applications and behavior of this compound would depend on its synthesis, purity, and the context in which it is used, such as in medicinal chemistry or materials science. Overall, its unique structural features make it a compound of interest in various chemical research fields.
Formula:C16H22N2O2
InChI:InChI=1S/C16H22N2O2/c19-15(20-12-14-4-2-1-3-5-14)18-11-8-16(13-18)6-9-17-10-7-16/h1-5,17H,6-13H2
InChI key:InChIKey=DFQASBLNWYEDIT-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC3(CC2)CCNCC3
Synonyms:- Phenylmethyl 2,8-diazaspiro[4.5]decane-2-carboxylate
- 2,8-Diazaspiro[4.5]decane-2-carboxylic acid, phenylmethyl ester
- 2-Cbz-2,8-diazaspiro[4.5]decane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.