
CAS 1086394-81-1
:Phenylmethyl 2,6-diazaspiro[3.5]nonane-6-carboxylate
Description:
Phenylmethyl 2,6-diazaspiro[3.5]nonane-6-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which includes a bicyclic framework featuring nitrogen atoms. This compound typically exhibits properties associated with both amines and esters due to the presence of the diaza (two nitrogen atoms) and carboxylate functional groups. The spiro structure contributes to its rigidity and may influence its reactivity and interaction with biological systems. The phenylmethyl group adds hydrophobic characteristics, potentially affecting solubility and permeability in various environments. Such compounds may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. Additionally, the presence of nitrogen atoms can impart basicity and influence the compound's behavior in different pH conditions. Overall, the unique structural features of Phenylmethyl 2,6-diazaspiro[3.5]nonane-6-carboxylate suggest potential utility in various chemical and biological applications.
Formula:C15H20N2O2
InChI:InChI=1S/C15H20N2O2/c18-14(19-9-13-5-2-1-3-6-13)17-8-4-7-15(12-17)10-16-11-15/h1-3,5-6,16H,4,7-12H2
InChI key:InChIKey=DMGJJLCZUUDTBP-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC3(CNC3)CCC2
Synonyms:- 2,6-Diazaspiro[3.5]nonane-6-carboxylic acid, phenylmethyl ester
- Phenylmethyl 2,6-diazaspiro[3.5]nonane-6-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
