
CAS 1086394-83-3
:Phenylmethyl 2,6-diazaspiro[3.5]nonane-2-carboxylate
Description:
Phenylmethyl 2,6-diazaspiro[3.5]nonane-2-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework containing nitrogen atoms. This compound belongs to a class of molecules known as spiro compounds, which are defined by having two or more rings that share a single atom. The presence of the phenylmethyl group contributes to its aromatic properties, while the diaza component indicates the incorporation of nitrogen atoms within the ring system, potentially influencing its reactivity and biological activity. The carboxylate functional group suggests that the compound may exhibit acidic properties and could participate in various chemical reactions, such as esterification or amidation. Its structural complexity may also impart interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Overall, the combination of its spiro structure, nitrogen content, and functional groups makes Phenylmethyl 2,6-diazaspiro[3.5]nonane-2-carboxylate a compound of interest in both synthetic and applied chemistry contexts.
Formula:C15H20N2O2
InChI:InChI=1S/C15H20N2O2/c18-14(19-9-13-5-2-1-3-6-13)17-11-15(12-17)7-4-8-16-10-15/h1-3,5-6,16H,4,7-12H2
InChI key:InChIKey=ARHCKLGJNYKXPW-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC3(C2)CCCNC3
Synonyms:- 2,6-Diazaspiro[3.5]nonane-2-carboxylic acid, phenylmethyl ester
- Phenylmethyl 2,6-diazaspiro[3.5]nonane-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
