CymitQuimica logo

CAS 1086394-98-0

:

Phenylmethyl 1,7-diazaspiro[4.4]nonane-7-carboxylate

Description:
Phenylmethyl 1,7-diazaspiro[4.4]nonane-7-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which features a combination of nitrogen atoms and a carboxylate functional group. This compound belongs to a class of molecules known for their potential biological activity, often explored in medicinal chemistry for their pharmacological properties. The presence of the phenylmethyl group contributes to its lipophilicity, potentially influencing its interaction with biological membranes and receptors. The diazaspiro framework introduces rigidity to the molecule, which can affect its conformational dynamics and reactivity. Additionally, the carboxylate group may participate in hydrogen bonding and ionic interactions, enhancing its solubility and reactivity in various chemical environments. Overall, the structural characteristics of Phenylmethyl 1,7-diazaspiro[4.4]nonane-7-carboxylate suggest it may have interesting applications in drug development and other fields of chemistry, although specific biological activities would require further investigation.
Formula:C15H20N2O2
InChI:InChI=1S/C15H20N2O2/c18-14(19-11-13-5-2-1-3-6-13)17-10-8-15(12-17)7-4-9-16-15/h1-3,5-6,16H,4,7-12H2
InChI key:InChIKey=VTCIBYYNHXLWPJ-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC3(CC2)CCCN3
Synonyms:
  • 1,7-Diazaspiro[4.4]nonane-7-carboxylic acid, phenylmethyl ester
  • Phenylmethyl 1,7-diazaspiro[4.4]nonane-7-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.