CymitQuimica logo

CAS 1086395-00-7

:

Phenylmethyl 1,7-diazaspiro[4.4]nonane-1-carboxylate

Description:
Phenylmethyl 1,7-diazaspiro[4.4]nonane-1-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework containing nitrogen atoms. This compound belongs to a class of molecules known as spiro compounds, which are defined by having two or more rings that share a single atom. The presence of the phenylmethyl group contributes to its aromatic characteristics, potentially influencing its reactivity and interactions with biological systems. The diaza component indicates the presence of two nitrogen atoms within the spiro structure, which may impart specific properties such as increased polarity or the ability to form hydrogen bonds. The carboxylate functional group suggests that the compound may exhibit acidic properties and could participate in various chemical reactions, including esterification or amidation. Overall, the structural features of Phenylmethyl 1,7-diazaspiro[4.4]nonane-1-carboxylate suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or biologically active compounds.
Formula:C15H20N2O2
InChI:InChI=1S/C15H20N2O2/c18-14(19-11-13-5-2-1-3-6-13)17-10-4-7-15(17)8-9-16-12-15/h1-3,5-6,16H,4,7-12H2
InChI key:InChIKey=SSUHQBDSVBXYAW-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2C3(CCC2)CCNC3
Synonyms:
  • Phenylmethyl 1,7-diazaspiro[4.4]nonane-1-carboxylate
  • 1,7-Diazaspiro[4.4]nonane-1-carboxylic acid, phenylmethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.