
CAS 1086395-14-3
:7-Methyl-1,7-diazaspiro[4.5]decane
Description:
7-Methyl-1,7-diazaspiro[4.5]decane is a bicyclic organic compound characterized by its unique spiro structure, which consists of two interconnected rings sharing a single atom. This compound features two nitrogen atoms within its framework, contributing to its diaza designation. The presence of a methyl group at the 7-position enhances its structural complexity and may influence its chemical reactivity and physical properties. Typically, compounds of this nature exhibit interesting biological activities, making them of interest in medicinal chemistry and drug development. The spirocyclic nature often leads to unique conformational properties, which can affect interactions with biological targets. Additionally, the compound's solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular geometry. As with many nitrogen-containing heterocycles, 7-Methyl-1,7-diazaspiro[4.5]decane may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes, which are essential for synthesizing more complex molecules in organic chemistry.
Formula:C9H18N2
InChI:InChI=1S/C9H18N2/c1-11-7-3-5-9(8-11)4-2-6-10-9/h10H,2-8H2,1H3
InChI key:InChIKey=FMORDJRXKBENEP-UHFFFAOYSA-N
SMILES:CN1CC2(CCC1)CCCN2
Synonyms:- 1,7-Diazaspiro[4.5]decane, 7-methyl-
- 7-Methyl-1,7-diazaspiro[4.5]decane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.