
CAS 1086395-23-4
:7-(Phenylmethyl)-1,7-diazaspiro[4.4]nonane
Description:
7-(Phenylmethyl)-1,7-diazaspiro[4.4]nonane is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework consisting of two nitrogen atoms integrated into the nonane ring system. This compound typically exhibits properties associated with both amines and spiro compounds, including potential biological activity due to the presence of the phenylmethyl group, which can influence its interaction with biological targets. The spiro structure contributes to its rigidity and may affect its conformational dynamics, impacting solubility and reactivity. Additionally, the presence of nitrogen atoms can impart basicity and potential for hydrogen bonding, which may enhance its solubility in polar solvents. The compound's molecular interactions and stability can be influenced by substituents on the phenyl ring, making it of interest in medicinal chemistry and material science. Overall, 7-(Phenylmethyl)-1,7-diazaspiro[4.4]nonane represents a fascinating subject for further research, particularly in the context of drug design and synthesis.
Formula:C14H20N2
InChI:InChI=1S/C14H20N2/c1-2-5-13(6-3-1)11-16-10-8-14(12-16)7-4-9-15-14/h1-3,5-6,15H,4,7-12H2
InChI key:InChIKey=RZOUQGOZESDBOJ-UHFFFAOYSA-N
SMILES:C(N1CC2(CC1)CCCN2)C3=CC=CC=C3
Synonyms:- 7-(Phenylmethyl)-1,7-diazaspiro[4.4]nonane
- 1,7-Diazaspiro[4.4]nonane, 7-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.