CAS 1086423-46-2

4-Chloro-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid

Description:

4-Chloro-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid is a complex organic compound characterized by its unique structural features, including a pyrrolo[2,3-b]pyridine core, which is a bicyclic heterocyclic structure. The presence of a chloro substituent introduces reactivity, while the tris(1-methylethyl)silyl group enhances its stability and solubility in organic solvents. This compound is likely to exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its reactivity and interactions with other molecules. Its silyl groups may also provide protective characteristics, making it useful in various synthetic applications. The compound's potential applications could span fields such as medicinal chemistry, materials science, and organic synthesis, where its unique structure may contribute to specific biological or chemical properties. Overall, the combination of its functional groups and structural complexity makes it a compound of interest for further research and development.

Formula: C₁₇H₂₅ClN₂O₂Si

InChI: InChI=1S/C17H25ClN2O2Si/c1-10(2)23(11(3)4,12(5)6)20-8-7-13-15(18)14(17(21)22)9-19-16(13)20/h7-12H,1-6H3,(H,21,22)

InChI key: InChIKey=FSTCBEJNOBRWEY-UHFFFAOYSA-N

SMILES: [Si](C(C)C)(C(C)C)(C(C)C)N1C=2C(C=C1)=C(Cl)C(C(O)=O)=CN2

Synonyms:

• 4-Chloro-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid
• 1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 4-chloro-1-[tris(1-methylethyl)silyl]-