
CAS 108655-24-9
:4-(3-Chloro-4-pyridazinyl)benzenamine
Description:
4-(3-Chloro-4-pyridazinyl)benzenamine, identified by its CAS number 108655-24-9, is an organic compound characterized by its aromatic structure, which includes a benzenamine moiety and a pyridazine ring. The presence of a chlorine atom at the 3-position of the pyridazine ring contributes to its reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and may have limited solubility in water, depending on the specific conditions. It is often utilized in pharmaceutical research and development due to its potential as a building block for various bioactive molecules. The compound's functional groups suggest it may participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in chemical reactions and biological systems. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C10H8ClN3
InChI:InChI=1S/C10H8ClN3/c11-10-9(5-6-13-14-10)7-1-3-8(12)4-2-7/h1-6H,12H2
InChI key:InChIKey=WWVDYNQFSWTUGI-UHFFFAOYSA-N
SMILES:ClC1=C(C2=CC=C(N)C=C2)C=CN=N1
Synonyms:- Benzenamine, 4-(3-chloro-4-pyridazinyl)-
- 4-(3-Chloro-4-pyridazinyl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.