CymitQuimica logo

CAS 108655-63-6

:

5-Isoxazolamine,3-(trifluoromethyl)-

Description:
5-Isoxazolamine, 3-(trifluoromethyl)- is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. The presence of a trifluoromethyl group (-CF3) at the 3-position of the isoxazole ring significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in the development of pharmaceuticals, particularly in areas targeting specific biological pathways. The CAS number 108655-63-6 uniquely identifies this compound in chemical databases, facilitating its study and application in research. As with many heterocyclic compounds, the reactivity and stability of 5-Isoxazolamine, 3-(trifluoromethyl)- can be influenced by the electronic effects of the trifluoromethyl group, which can also affect its interactions with biological targets. Overall, this compound represents a unique structure with potential utility in various chemical and pharmaceutical applications.
Formula:C4H3F3N2O
InChI:InChI=1/C4H3F3N2O/c5-4(6,7)2-1-3(8)10-9-2/h1H,8H2
InChI key:PAYOWUGPXPPRPB-UHFFFAOYSA-N
SMILES:c1c(C(F)(F)F)noc1N
Synonyms:
  • 3-TRIFLUOROMETHYL-5-aminoIsoxazole
  • 3-(Trifluoromethyl)-1,2-Oxazol-5-Amine
Found 4 products.