CymitQuimica logo

CAS 1086599-76-9

:

2-Bromo-4-chloro-α-methylbenzenemethanamine

Description:
2-Bromo-4-chloro-α-methylbenzenemethanamine, with the CAS number 1086599-76-9, is an organic compound characterized by the presence of both bromine and chlorine substituents on a benzene ring, along with an amino group (-NH2) attached to a benzylic carbon. This compound features a methyl group adjacent to the amino group, which influences its steric and electronic properties. The presence of halogens (bromine and chlorine) typically enhances the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The amino group contributes to its basicity and potential for forming hydrogen bonds, which can affect its solubility in polar solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally, as they can vary based on the compound's purity and the conditions under which they are measured.
Formula:C8H9BrClN
InChI:InChI=1S/C8H9BrClN/c1-5(11)7-3-2-6(10)4-8(7)9/h2-5H,11H2,1H3
InChI key:InChIKey=VSMZRZUTLAHOGD-UHFFFAOYSA-N
SMILES:C(C)(N)C1=C(Br)C=C(Cl)C=C1
Synonyms:
  • 2-Bromo-4-chloro-α-methylbenzenemethanamine
  • Benzenemethanamine, 2-bromo-4-chloro-α-methyl-
  • 1-(2-Bromo-4-chlorophenyl)ethan-1-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.