CymitQuimica logo

CAS 108665-95-8

:

3-Methyl-2-(phenylsulfonyl)-1H-indole

Description:
3-Methyl-2-(phenylsulfonyl)-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a methyl group at the 3-position and a phenylsulfonyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic indole core. The phenylsulfonyl moiety can enhance the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of the sulfonyl group can also influence the compound's electronic properties, potentially affecting its interactions with biological targets. Overall, 3-Methyl-2-(phenylsulfonyl)-1H-indole is a versatile compound with applications in research and development within the fields of organic chemistry and pharmacology.
Formula:C15H13NO2S
InChI:InChI=1S/C15H13NO2S/c1-11-13-9-5-6-10-14(13)16-15(11)19(17,18)12-7-3-2-4-8-12/h2-10,16H,1H3
InChI key:InChIKey=JVPWRYGAIHPYCZ-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=C(C)C=2C(N1)=CC=CC2)C3=CC=CC=C3
Synonyms:
  • 3-Methyl-2-(phenylsulfonyl)-1H-indole
  • 2-(Benzenesulfonyl)-3-methyl-1H-indole
  • 1H-Indole, 3-methyl-2-(phenylsulfonyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.