
CAS 1086775-09-8
:Indolo[2,3-a]quinolizine, 1,2,3,4,6,7,12,12b-octahydro-12b-methyl-12-(phenylmethyl)-, hydrochloride (1:1)
Description:
Indolo[2,3-a]quinolizine, specifically the compound identified as 1,2,3,4,6,7,12,12b-octahydro-12b-methyl-12-(phenylmethyl)-, hydrochloride (1:1), is a complex organic molecule characterized by its bicyclic structure that incorporates both indole and quinolizine moieties. This compound features multiple fused rings, contributing to its potential biological activity and pharmacological properties. The presence of a hydrochloride salt indicates that it is a protonated form, which often enhances solubility in aqueous environments, making it suitable for various applications in medicinal chemistry. The octahydro configuration suggests that the compound is saturated, which may influence its reactivity and stability. Additionally, the presence of a phenylmethyl group can enhance lipophilicity, potentially affecting its interaction with biological membranes. Overall, this compound may exhibit interesting properties for research in drug development, particularly in the fields of neuropharmacology or oncology, although specific biological activities would require further investigation.
Formula:C23H26N2·ClH
InChI:InChI=1S/C23H26N2.ClH/c1-23-14-7-8-15-24(23)16-13-20-19-11-5-6-12-21(19)25(22(20)23)17-18-9-3-2-4-10-18;/h2-6,9-12H,7-8,13-17H2,1H3;1H
InChI key:InChIKey=YRBXFHROVIASTF-UHFFFAOYSA-N
SMILES:C(N1C2=C(C=3C1=CC=CC3)CCN4C2(C)CCCC4)C5=CC=CC=C5.Cl
Synonyms:- Indolo[2,3-a]quinolizine, 1,2,3,4,6,7,12,12b-octahydro-12b-methyl-12-(phenylmethyl)-, hydrochloride (1:1)
- 12-Benzyl-12b-methyl-1,2,3,4,6,7,12,12b-octahydro-indolo[2,3-a]quinolizine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
12-Benzyl-12b-methyl-1,2,3,4,6,7,12,12b-octahydro-indolo[2,3-a]quinolizine Hydrochloride
CAS:Controlled ProductFormula:C23H26N2•HClColor and Shape:NeatMolecular weight:330.48 + 36.46
