CAS 108679-71-6

3-amino-2-chlorobenzoic acid

Description:

3-Amino-2-chlorobenzoic acid, with the CAS number 108679-71-6, is an aromatic amino acid derivative characterized by the presence of both an amino group (-NH2) and a carboxylic acid group (-COOH) on a chlorinated benzene ring. Specifically, the amino group is located at the meta position relative to the carboxylic acid, while a chlorine atom is positioned at the ortho position. This compound typically appears as a solid and is soluble in polar solvents, such as water and alcohols, due to its polar functional groups. It exhibits properties typical of amino acids, including the ability to participate in hydrogen bonding and form salts. The presence of the chlorine atom can influence its reactivity and biological activity, making it of interest in pharmaceutical and chemical research. Additionally, 3-amino-2-chlorobenzoic acid may serve as an intermediate in the synthesis of various organic compounds, including dyes and pharmaceuticals, due to its functional groups that allow for further chemical modifications.

Formula: C₇H₆ClNO₂

InChI: InChI=1/C7H6ClNO2/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3H,9H2,(H,10,11)

SMILES: c1cc(c(c(c1)N)Cl)C(=O)O

3-Amino-2-chlorobenzoic acid

CAS: 108679-71-6

Formula: C₇H₆ClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 171.5810

Ref: IN-DA007U4Z

3-Amino-2-chlorobenzoic acid

CAS: 108679-71-6

Ref: 7W-GM5839

3-Amino-2-chlorobenzoic acid

CAS: 108679-71-6

3-Amino-2-chlorobenzoic acid

Purity: 98%

Molecular weight: 171.58g/mol

Ref: 54-OR12772

3-Amino-2-chlorobenzoic acid

CAS: 108679-71-6

3-Amino-2-chlorobenzoic acid is a molecule that belongs to the group of acidic compounds. It has been shown to induce apoptosis and inhibit cell proliferation in human immunodeficient virus (HIV) cells, as well as inhibit the growth of cancer cells. 3-Amino-2-chlorobenzoic acid also inhibits histone deacetylase, which is an enzyme that controls gene expression by removing acetyl groups from lysine residues on the N-terminal tails of histones. This inhibition may be responsible for its anticancer activity. 3-Amino-2-chlorobenzoic acid is metabolized by oxidation to chlorinated derivatives and excreted via the kidneys. It has been shown to have a pharmacokinetic profile in rats similar to that observed with other triazines such as atrazine and simazine. The elimination half-life of 3-amino-2-chlorob

Formula: C₇H₆ClNO₂

Purity: Min. 95%

Color and Shape: Off-White Powder

Molecular weight: 171.58 g/mol

Ref: 3D-FA55281

3-Amino-2-chlorobenzoic acid

CAS: 108679-71-6

Formula: C₇H₆ClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 171.58

Ref: 10-F065700