CAS 108698-02-8
:cis-7,10,13,16,19-docosapentaenoic acid methyl es
Description:
Cis-7,10,13,16,19-docosapentaenoic acid methyl ester, identified by its CAS number 108698-02-8, is a methyl ester derivative of a polyunsaturated fatty acid. This compound is characterized by a long carbon chain, specifically containing 22 carbon atoms and multiple double bonds, which are positioned at the 7th, 10th, 13th, 16th, and 19th carbon atoms in the cis configuration. The presence of these double bonds contributes to its unsaturated nature, influencing its physical properties such as melting point and solubility. As a methyl ester, it is typically more soluble in organic solvents compared to its acid form. This compound is of interest in various fields, including nutrition and biochemistry, due to its potential health benefits associated with omega-3 fatty acids. Additionally, its structural characteristics may play a role in its biological activity and interactions within lipid membranes. Overall, cis-7,10,13,16,19-docosapentaenoic acid methyl ester exemplifies the complexity and significance of polyunsaturated fatty acids in both natural and synthetic contexts.
Formula:C23H36O2
InChI:InChI=1/C23H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25-2/h4-5,7-8,10-11,13-14,16-17H,3,6,9,12,15,18-22H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16-
SMILES:CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)OC
Synonyms:- Methyl all-cis-7,10,13,16,19-docosapentaenoate
- methyl (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Docosapentaenoic Acid methyl ester
CAS:Formula:C23H36O2Purity:97%Color and Shape:LiquidMolecular weight:344.5307cis-7,10,13,16,19-Docosapentaenoic methyl ester
CAS:Formula:C23H36O2Purity:≥ 99.0%Color and Shape:Clear, colourless liquidMolecular weight:344.53(7Z,10Z,13Z,16Z,19Z)-Methyl docosa-7,10,13,16,19-pentaenoate
CAS:(7Z,10Z,13Z,16Z,19Z)-Methyl docosa-7,10,13,16,19-pentaenoatePurity:97%Molecular weight:344.54g/molMethyl 7(Z),10(Z),13(Z),16(Z),19(Z)-Docosapentaenoate
CAS:Formula:C23H36O2Purity:>99%Color and Shape:LiquidMolecular weight:344.53(All-Z)-7,10,13,16,19-Docosapentaenoic Acid Methyl Ester
CAS:Controlled ProductFormula:C23H36O2Color and Shape:NeatMolecular weight:344.53(All-Z)-7,10,13,16,19-Docosapentaenoic Acid Methyl Ester-d3
CAS:Controlled ProductFormula:C23D3H33O2Color and Shape:NeatMolecular weight:347.549Methyl all-cis-7,10,13,16,19-docosapentaenoate
CAS:Methyl all-cis-7,10,13,16,19-docosapentaenoate is a methyl ester of an omega-3 polyunsaturated fatty acid, which is naturally sourced from marine oils, particularly fish and algae. This compound is characterized by its all-cis configuration, contributing to its unique biochemical properties. In terms of mode of action, this molecule is involved in modulating cell membrane fluidity and acting as a precursor to bioactive lipid mediators with anti-inflammatory and immunomodulatory functions.Formula:C23H36O2Purity:Min. 95%Molecular weight:344.53 g/mol





