CAS 1087-06-5
:Meprophendiol
Description:
Meprophendiol, with the CAS number 1087-06-5, is a chemical compound primarily recognized for its role as a pharmaceutical intermediate. It is characterized by its molecular structure, which includes hydroxyl groups that contribute to its solubility in polar solvents. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. Meprophendiol exhibits moderate stability under standard conditions but may undergo degradation when exposed to extreme pH levels or high temperatures. Its chemical properties allow it to participate in various reactions, making it useful in the synthesis of other organic compounds. Additionally, it is important to handle Meprophendiol with care, as it may pose health risks if ingested or inhaled, necessitating appropriate safety measures during its use in laboratory or industrial settings. Overall, Meprophendiol serves as a valuable building block in organic synthesis, particularly in the development of pharmaceutical agents.
Formula:C13H18O5
InChI:InChI=1/C13H18O5/c1-3-11(16)9-4-5-12(13(6-9)17-2)18-8-10(15)7-14/h4-6,10,14-15H,3,7-8H2,1-2H3
SMILES:CCC(=O)c1ccc(c(c1)OC)OCC(CO)O
Synonyms:- Propiophenone, 4'-(2,3-dihydroxypropoxy)-3'-methoxy-
- 1-(4-(2,3-Dihydroxypropoxy)-3-methoxyphenyl)-1-propanone
- 3-(2-Methoxy-4-propionylphenoxy)-1,2-propanediol
- 3-(4-Propionyl-2-methoxyphenoxy)-1,2-propanediol
- 3-(p-Propionyl-o-methoxyphenoxy)-1,2-propanediol
- 4'-(2,3-Dihydroxypropoxy)-3-methoxypropiophenone
- Brn 2057739
- Da 1128
- 1-[4-(2,3-Dihydroxypropoxy)-3-Methoxyphenyl]Propan-1-One
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
