CAS 108711-80-4
:5-(2,2-difluorovinyl)-2'-deoxyuridine
Description:
5-(2,2-Difluorovinyl)-2'-deoxyuridine, commonly referred to as DFV-UD, is a nucleoside analog that exhibits antiviral properties, particularly against certain viruses such as HIV. This compound features a modified uridine structure, where the 2'-deoxy sugar is attached to a vinyl group that is further substituted with two fluorine atoms, enhancing its stability and bioactivity. The presence of the difluorovinyl moiety contributes to its mechanism of action, which involves interference with viral replication processes. DFV-UD is typically characterized by its solid-state form, with a specific melting point and solubility profile that can vary based on the solvent used. Its chemical structure allows it to mimic natural nucleosides, making it a potential candidate for therapeutic applications in antiviral treatments. Additionally, the compound's pharmacokinetics, including absorption, distribution, metabolism, and excretion, are crucial for understanding its efficacy and safety in clinical settings. Overall, 5-(2,2-difluorovinyl)-2'-deoxyuridine represents a significant advancement in the development of antiviral agents.
Formula:C11H12F2N2O5
InChI:InChI=1/C11H12F2N2O5/c12-8(13)1-5-3-15(11(19)14-10(5)18)9-2-6(17)7(4-16)20-9/h1,3,6-7,9,16-17H,2,4H2,(H,14,18,19)/t6-,7+,9+/m0/s1
Synonyms:- 2'-Deoxy-5-(2,2-difluorovinyl)uridine
- 5-Dfv-DU
- Uridine, 2'-deoxy-5-(2,2-difluoroethenyl)-
- 2'-Deoxy-5-(2,2-Difluoroethenyl)Uridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.