CAS 108724-17-0

3-(Dimethylamino)-2-hydroxypropanoic acid

Description:

3-(Dimethylamino)-2-hydroxypropanoic acid, also known as DMAPA, is an organic compound characterized by its amino acid-like structure. It features a hydroxyl group (-OH) and a dimethylamino group (-N(CH3)2) attached to a propanoic acid backbone. This compound is typically a white to off-white crystalline solid and is soluble in water due to the presence of both polar hydroxyl and amino groups. DMAPA is known for its role in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals, where it can act as a building block or intermediate. Its properties include moderate acidity, which is influenced by the carboxylic acid functional group, and it can participate in hydrogen bonding due to the hydroxyl and amino functionalities. Additionally, DMAPA's dimethylamino group can enhance its reactivity, making it a useful compound in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₅H₁₁NO₃

InChI: InChI=1S/C5H11NO3/c1-6(2)3-4(7)5(8)9/h4,7H,3H2,1-2H3,(H,8,9)

InChI key: InChIKey=YHSIOCMDGDQDQA-UHFFFAOYSA-N

SMILES: C(CN(C)C)(C(O)=O)O

Synonyms:

• 3-Dimethylamino-2-hydroxypropionic acid
• 3-(Dimethylamino)-2-hydroxypropanoic acid
• Isoserine, N,N-dimethyl-
• Propanoic acid, 3-(dimethylamino)-2-hydroxy-