
CAS 1087353-56-7
:2-Fluoro-4-[[(phenylmethoxy)carbonyl]amino]benzoic acid
Description:
2-Fluoro-4-[[(phenylmethoxy)carbonyl]amino]benzoic acid is a chemical compound characterized by its complex structure, which includes a fluorine atom, a benzoic acid moiety, and an amide functional group. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its biological activity. The phenylmethoxycarbonyl group contributes to the compound's stability and solubility properties, making it potentially useful in pharmaceutical applications. This compound may exhibit specific interactions with biological targets due to its functional groups, which can affect its pharmacokinetics and pharmacodynamics. Additionally, the presence of the carboxylic acid group suggests that it can participate in acid-base reactions, while the amine group may engage in hydrogen bonding. Overall, the unique combination of functional groups in 2-Fluoro-4-[[(phenylmethoxy)carbonyl]amino]benzoic acid suggests potential utility in medicinal chemistry, particularly in the development of novel therapeutic agents.
Formula:C15H12FNO4
InChI:InChI=1S/C15H12FNO4/c16-13-8-11(6-7-12(13)14(18)19)17-15(20)21-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,17,20)(H,18,19)
InChI key:InChIKey=XKCXYFUZWNMSQU-UHFFFAOYSA-N
SMILES:N(C(OCC1=CC=CC=C1)=O)C2=CC(F)=C(C(O)=O)C=C2
Synonyms:- 4-(((Benzyloxy)carbonyl)amino)-2-fluorobenzoic acid
- 2-Fluoro-4-[[(phenylmethoxy)carbonyl]amino]benzoic acid
- Benzoic acid, 2-fluoro-4-[[(phenylmethoxy)carbonyl]amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.