CAS 108736-35-2: lanreotide
Description:Lanreotide is a synthetic octapeptide analog of somatostatin, a naturally occurring hormone that inhibits the secretion of several other hormones. It is primarily used in the treatment of acromegaly, a condition characterized by excessive growth hormone production, and for managing certain neuroendocrine tumors. Lanreotide functions by binding to somatostatin receptors, leading to a decrease in growth hormone and insulin-like growth factor 1 (IGF-1) levels. The substance is typically administered via subcutaneous injection and has a prolonged half-life, allowing for less frequent dosing compared to other treatments. Lanreotide is known for its stability and solubility in aqueous solutions, which facilitates its use in clinical settings. Common side effects may include gastrointestinal disturbances, such as diarrhea and abdominal pain, as well as potential impacts on glucose metabolism. Overall, lanreotide represents an important therapeutic option in the management of specific endocrine disorders, demonstrating the significance of peptide-based drugs in modern medicine.
Formula:C54H69N11O10S2
InChI:InChI=1/C54H69N11O10S2/c1-29(2)45-54(75)63-44(53(74)65-46(30(3)66)47(57)68)28-77-76-27-43(62-48(69)38(56)23-32-15-18-33-10-4-5-11-34(33)22-32)52(73)60-41(24-31-16-19-36(67)20-17-31)50(71)61-42(25-35-26-58-39-13-7-6-12-37(35)39)51(72)59-40(49(70)64-45)14-8-9-21-55/h4-7,10-13,15-20,22,26,29-30,38,40-46,58,66-67H,8-9,14,21,23-25,27-28,55-56H2,1-3H3,(H2,57,68)(H,59,72)(H,60,73)(H,61,71)(H,62,69)(H,63,75)(H,64,70)(H,65,74)
- Synonyms:
- B-naphthyl-D-ala-cys-tyr-D-trp*lys-val-cys-thr am
- 10-(4-aminobutyl)-N-(1-amino-3-hydroxy-1-oxobutan-2-yl)-16-(4-hydroxybenzyl)-13-(1H-indol-3-ylmethyl)-19-{[3-(naphthalen-2-yl)alanyl]amino}-6,9,12,15,18-pentaoxo-7-(propan-2-yl)-1,2-dithia-5,8,11,14,17-pentaazacycloicosane-4-carboxamide acetate (1:1)
- 10-(4-aminobutyl)-N-(1-amino-3-hydroxy-1-oxobutan-2-yl)-16-(4-hydroxybenzyl)-13-(1H-indol-3-ylmethyl)-19-{[3-(naphthalen-2-yl)alanyl]amino}-6,9,12,15,18-pentaoxo-7-(propan-2-yl)-1,2-dithia-5,8,11,14,17-pentaazacycloicosane-4-carboxamide
- Laromustine