CAS 1087411-17-3

4-Fluoro-α,β-dimethylbenzeneethanol

Description:

4-Fluoro-α,β-dimethylbenzeneethanol, also known by its CAS number 1087411-17-3, is an organic compound characterized by the presence of a fluorine atom and a hydroxyl group attached to a dimethyl-substituted benzene ring. This compound features a phenolic structure, which typically imparts certain properties such as increased polarity and potential for hydrogen bonding due to the hydroxyl group. The fluorine substitution can enhance the compound's lipophilicity and influence its reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the dimethyl groups can also affect the steric hindrance and electronic properties of the molecule, potentially impacting its biological activity and solubility. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the molecular interactions and the overall structure. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.

Formula: C₁₀H₁₃FO

InChI: InChI=1S/C10H13FO/c1-7(8(2)12)9-3-5-10(11)6-4-9/h3-8,12H,1-2H3

InChI key: InChIKey=WUHCMAHDDSWFLE-UHFFFAOYSA-N

SMILES: C(C(C)O)(C)C1=CC=C(F)C=C1

Synonyms:

• 4-Fluoro-α,β-dimethylbenzeneethanol
• Benzeneethanol, 4-fluoro-α,β-dimethyl-