CAS 108750-13-6
:CALCEIN DISODIUM SALT, INDICATOR FOR COM PLEXOMETRY
Description:
Calcein disodium salt, with the CAS number 108750-13-6, is a fluorescent dye commonly used as an indicator in complexometric titrations, particularly for determining metal ions such as calcium and magnesium. This compound is characterized by its bright green fluorescence, which is highly sensitive to changes in pH and the presence of metal ions. In aqueous solutions, calcein disodium salt exhibits a strong affinity for divalent metal ions, forming stable complexes that can be detected through fluorescence changes. Its solubility in water makes it suitable for various analytical applications, including environmental monitoring and biological studies. The compound is also known for its low toxicity, making it a safer alternative to some traditional indicators. Additionally, calcein disodium salt can be utilized in cell biology for tracking live cells, as it can permeate cell membranes and fluoresce upon binding to intracellular calcium. Overall, its unique properties make it a valuable tool in both analytical chemistry and biological research.
Formula:C30H24N2O13·2Na
InChI:InChI=1/C30H26N2O13.2Na/c33-21-7-5-19-27(16(21)9-31(11-23(35)36)12-24(37)38)44-28-17(10-32(13-25(39)40)14-26(41)42)22(34)8-6-20(28)30(19)18-4-2-1-3-15(18)29(43)45-30;;/h1-8,33-34H,9-14H2,(H,35,36)(H,37,38)(H,39,40)(H,41,42);;/q;2*+1/p-2
SMILES:c1ccc2c(c1)C(=O)OC12c2ccc(c(CN(CC(=O)O)CC(=O)O)c2Oc2c(CN(CC(=O)O)CC(=O)O)c(ccc12)O)O.[Na].[Na]
Synonyms:- Calcein sodium salt, ca 2-3 Na
- Bis[N,N-di(carboxymethyl)aminomethyl]fluorescein disodium salt, Fluorescein-bismethyliminodiacetic acid disodium salt
- disodium 2,2'-[(3',6'-dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-4',5'-diyl)bis{methanediyl[(carboxymethyl)imino]}]diacetate (non-preferred name)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glycine, N,N′-[(3′,6′-dihydroxy-3-oxospiro[isobenzofuran-1(3H),9′-[9H]xanthene]-2,7-diyl)bis(methylene)]bis[N-(carboxymethyl)-, sodium salt (1:?)
CAS:Formula:C30H25N2NaO13Color and Shape:SolidMolecular weight:644.5149
