CAS 1087606-48-1

4-Methyl-2-[(methylsulfonyl)amino]-5-pyrimidinecarboxylic acid

Description:

4-Methyl-2-[(methylsulfonyl)amino]-5-pyrimidinecarboxylic acid, identified by its CAS number 1087606-48-1, is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a methylsulfonylamino group enhances its solubility in polar solvents and may influence its biological activity. Typically, such compounds are of interest in medicinal chemistry due to their potential therapeutic applications, particularly in the development of pharmaceuticals. The methyl group at the 4-position and the sulfonamide functionality can affect the compound's interaction with biological targets, potentially influencing its pharmacokinetic and pharmacodynamic properties. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, this compound represents a class of molecules that may exhibit significant biological activity, warranting further investigation.

Formula: C₇H₉N₃O₄S

InChI: InChI=1S/C7H9N3O4S/c1-4-5(6(11)12)3-8-7(9-4)10-15(2,13)14/h3H,1-2H3,(H,11,12)(H,8,9,10)

InChI key: InChIKey=KIKJLBQXPCTDFG-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(C)=NC(NS(C)(=O)=O)=NC1

Synonyms:

• 4-Methyl-2-[(methylsulfonyl)amino]-5-pyrimidinecarboxylic acid
• 5-Pyrimidinecarboxylic acid, 4-methyl-2-[(methylsulfonyl)amino]-