CAS 1087611-41-3

2,4,5-Trimethyl-1-(3-pyridinylmethyl)-1H-pyrrole-3-carboxaldehyde

Description:

2,4,5-Trimethyl-1-(3-pyridinylmethyl)-1H-pyrrole-3-carboxaldehyde is a complex organic compound characterized by its pyrrole and pyridine moieties, which contribute to its unique chemical properties. The presence of multiple methyl groups enhances its hydrophobic character, while the aldehyde functional group introduces reactivity, particularly in condensation reactions and as a potential electrophile. This compound is likely to exhibit moderate solubility in organic solvents due to its non-polar methyl groups, while the polar aldehyde and pyridine functionalities may allow for some interaction with polar solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrrole and pyridine derivatives. Additionally, the compound may exhibit interesting optical properties, making it a candidate for studies in materials science. As with many organic compounds, safety precautions should be taken when handling it, as its reactivity and potential toxicity are not fully characterized in public databases.

Formula: C₁₄H₁₆N₂O

InChI: InChI=1S/C14H16N2O/c1-10-11(2)16(12(3)14(10)9-17)8-13-5-4-6-15-7-13/h4-7,9H,8H2,1-3H3

InChI key: InChIKey=YTGMWFUEYYPRHL-UHFFFAOYSA-N

SMILES: C(N1C(C)=C(C=O)C(C)=C1C)C=2C=CC=NC2

Synonyms:

• 2,4,5-Trimethyl-1-(3-pyridinylmethyl)-1H-pyrrole-3-carboxaldehyde
• 1H-Pyrrole-3-carboxaldehyde, 2,4,5-trimethyl-1-(3-pyridinylmethyl)-