CAS 108763-47-9

methyl 1-benzofuran-5-carboxylate

Description:

Methyl 1-benzofuran-5-carboxylate is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. This compound features a carboxylate functional group, specifically an ester, where a methyl group is attached to the carboxylic acid moiety. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the benzofuran ring contributes to its aromatic properties, which can influence its reactivity and interactions with other chemical species. Methyl 1-benzofuran-5-carboxylate is often studied for its potential applications in organic synthesis, pharmaceuticals, and as a building block in the development of various chemical compounds. Its solubility in organic solvents and moderate stability under standard conditions make it a useful intermediate in chemical reactions. Additionally, the compound may exhibit biological activity, which warrants further investigation in medicinal chemistry and related fields. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₀H₈O₃

InChI: InChI=1/C10H8O3/c1-12-10(11)8-2-3-9-7(6-8)4-5-13-9/h2-6H,1H3

SMILES: COC(=O)c1ccc2c(cco2)c1

Synonyms:

• 5-Benzofurancarboxylic acid, methyl ester
• Methyl 1-benzofuran-5-carboxylate

Methyl benzofuran-5-carboxylate

CAS: 108763-47-9

Formula: C₁₀H₈O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 176.1687

Ref: IN-DA003RZF

Methyl benzofuran-5-carboxylate

CAS: 108763-47-9

Methyl benzofuran-5-carboxylate

Purity: 97%

Molecular weight: 176.17g/mol

Ref: 54-OR953290

Methyl benzofuran-5-carboxylate

CAS: 108763-47-9

Formula: C₁₀H₈O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 176.171

Ref: 10-F226112