CAS 1087659-16-2
:4-Iodo-5-methoxy-N-phenyl-3-pyridinecarboxamide
Description:
4-Iodo-5-methoxy-N-phenyl-3-pyridinecarboxamide is a chemical compound characterized by its unique structural features, including an iodine atom, a methoxy group, and a phenyl group attached to a pyridinecarboxamide framework. This compound belongs to the class of pyridine derivatives, which are known for their diverse biological activities. The presence of the iodine atom can influence the compound's reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The methoxy group may enhance lipophilicity, potentially affecting the compound's solubility and permeability. Additionally, the phenyl group contributes to the overall stability and electronic properties of the molecule. The compound's specific interactions with biological targets can be explored through various assays, making it of interest in drug discovery and development. Overall, 4-Iodo-5-methoxy-N-phenyl-3-pyridinecarboxamide exemplifies the complexity and versatility of pyridine-based compounds in chemical and pharmaceutical research.
Formula:C13H11IN2O2
InChI:InChI=1S/C13H11IN2O2/c1-18-11-8-15-7-10(12(11)14)13(17)16-9-5-3-2-4-6-9/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=ZNJHYEHUEGDJGA-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)(=O)C=2C(I)=C(OC)C=NC2
Synonyms:- 4-Iodo-5-methoxy-N-phenyl-3-pyridinecarboxamide
- 3-Pyridinecarboxamide, 4-iodo-5-methoxy-N-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
