CAS 1087659-22-0
:3-(5-Bromo-3-methoxy-2-pyridinyl)-2-propyn-1-ol
Description:
3-(5-Bromo-3-methoxy-2-pyridinyl)-2-propyn-1-ol is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a bromine atom and a methoxy group, along with a propynol functional group. The presence of the bromine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The methoxy group enhances its solubility in organic solvents and may influence its biological activity. This compound is likely to exhibit polar characteristics due to the hydroxyl (-OH) group, which can participate in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be influenced by the interactions between its functional groups and the surrounding environment. Overall, 3-(5-Bromo-3-methoxy-2-pyridinyl)-2-propyn-1-ol represents a versatile structure with potential utility in various chemical and biological applications.
Formula:C9H8BrNO2
InChI:InChI=1S/C9H8BrNO2/c1-13-9-5-7(10)6-11-8(9)3-2-4-12/h5-6,12H,4H2,1H3
InChI key:InChIKey=KWDTVLGWUDQYDC-UHFFFAOYSA-N
SMILES:C(#CCO)C1=C(OC)C=C(Br)C=N1
Synonyms:- 2-Propyn-1-ol, 3-(5-bromo-3-methoxy-2-pyridinyl)-
- 3-(5-Bromo-3-methoxy-2-pyridinyl)-2-propyn-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
