CAS 1087659-23-1

5-Bromo-3-methoxy-2-[2-(trimethylsilyl)ethynyl]pyridine

Description:

5-Bromo-3-methoxy-2-[2-(trimethylsilyl)ethynyl]pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methoxy group at the 3-position contributes to its reactivity and solubility properties. The compound also features a trimethylsilyl group attached to an ethynyl moiety at the 2-position, which enhances its stability and can facilitate various synthetic transformations. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in cross-coupling reactions and other transformations. Its unique structure allows for potential applications in medicinal chemistry, where modifications can lead to biologically active compounds. Additionally, the presence of the trimethylsilyl group can improve the compound's volatility and solubility in organic solvents, making it useful in various chemical processes.

Formula: C₁₁H₁₄BrNOSi

InChI: InChI=1S/C11H14BrNOSi/c1-14-11-7-9(12)8-13-10(11)5-6-15(2,3)4/h7-8H,1-4H3

InChI key: InChIKey=JLHCBUZCMGZUAK-UHFFFAOYSA-N

SMILES: C(#C[Si](C)(C)C)C1=C(OC)C=C(Br)C=N1

Synonyms:

• Pyridine, 5-bromo-3-methoxy-2-[2-(trimethylsilyl)ethynyl]-
• 5-Bromo-3-methoxy-2-[2-(trimethylsilyl)ethynyl]pyridine