CAS 1087659-25-3

5-Bromo-3-methoxy-2-(trimethylsilyl)pyridine

Description:

5-Bromo-3-methoxy-2-(trimethylsilyl)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methoxy group at the 3-position contributes to its reactivity and solubility properties. The trimethylsilyl group at the 2-position enhances the compound's stability and can influence its electronic properties, making it useful in various synthetic applications. This compound is typically used in organic synthesis, particularly in the preparation of more complex molecules, due to its ability to participate in nucleophilic substitution reactions and other transformations. It is important to handle this substance with care, as it may pose health risks if inhaled or ingested, and appropriate safety measures should be taken during its use in laboratory settings. Additionally, its solubility in organic solvents makes it suitable for various chemical reactions and applications in medicinal chemistry and materials science.

Formula: C₉H₁₄BrNOSi

InChI: InChI=1S/C9H14BrNOSi/c1-12-8-5-7(10)6-11-9(8)13(2,3)4/h5-6H,1-4H3

InChI key: InChIKey=VIXHZRDZEGWBCX-UHFFFAOYSA-N

SMILES: [Si](C)(C)(C)C1=C(OC)C=C(Br)C=N1

Synonyms:

• 5-Bromo-3-methoxy-2-(trimethylsilyl)pyridine
• Pyridine, 5-bromo-3-methoxy-2-(trimethylsilyl)-
• (5-bromo-3-methoxypyridin-2-yl)-trimethylsilane