CAS 1087659-26-4
:2-Bromo-6-iodo-3-pyridinyl 1,1-dimethylethyl carbonate
Description:
2-Bromo-6-iodo-3-pyridinyl 1,1-dimethylethyl carbonate is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with bromine and iodine atoms, as well as a carbonate functional group. The presence of the bromine and iodine substituents contributes to its potential reactivity and biological activity, making it of interest in various fields, including medicinal chemistry and agrochemicals. The carbonate moiety indicates that this compound may exhibit properties typical of esters, such as susceptibility to hydrolysis under certain conditions. Additionally, the presence of the bulky 1,1-dimethylethyl group may influence the compound's steric properties and solubility. Overall, this compound's specific characteristics, including its molecular weight, solubility, and stability, would be essential for understanding its behavior in chemical reactions and potential applications. Further studies would be necessary to explore its reactivity, biological activity, and potential uses in synthesis or as a pharmaceutical agent.
Formula:C10H11BrINO3
InChI:InChI=1S/C10H11BrINO3/c1-10(2,3)16-9(14)15-6-4-5-7(12)13-8(6)11/h4-5H,1-3H3
InChI key:InChIKey=NTCCNGUKLGPNQT-UHFFFAOYSA-N
SMILES:O(C(OC(C)(C)C)=O)C1=C(Br)N=C(I)C=C1
Synonyms:- 2-Bromo-6-iodo-3-pyridinyl 1,1-dimethylethyl carbonate
- Carbonic acid, 2-bromo-6-iodo-3-pyridinyl 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.