CAS 1087659-28-6: 3-(5,6-Dimethoxy-2-pyridinyl)-2-propyn-1-ol
Description:3-(5,6-Dimethoxy-2-pyridinyl)-2-propyn-1-ol, identified by its CAS number 1087659-28-6, is a chemical compound characterized by its unique structural features, including a pyridine ring substituted with two methoxy groups and a propynol moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and solubility. The presence of the hydroxyl group (-OH) suggests potential for hydrogen bonding, enhancing its solubility in polar solvents. The methoxy groups contribute to the electron-donating character of the pyridine ring, potentially affecting its electronic properties and reactivity in various chemical reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its synthesis and applications could be explored further in the context of drug development or as a building block in organic synthesis. Overall, the combination of its functional groups and structural features positions it as a versatile compound in chemical research.
Formula:C10H11NO3
InChI:InChI=1S/C10H11NO3/c1-13-9-6-5-8(4-3-7-12)11-10(9)14-2/h5-6,12H,7H2,1-2H3
InChI key:InChIKey=OYBROCBIXNDTLK-UHFFFAOYSA-N
SMILES:OCC#CC=1N=C(OC)C(OC)=CC1
- Synonyms:
- 2-Propyn-1-ol, 3-(5,6-dimethoxy-2-pyridinyl)-
- 3-(5,6-Dimethoxy-2-pyridinyl)-2-propyn-1-ol
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-(5,6-Dimethoxypyridin-2-yl)prop-2-yn-1-ol REF: 10-F615912CAS: 1087659-28-6 | 97% | - - - | Discontinued product |
![]() | 3-(5,6-Dimethoxypyridin-2-yl)prop-2-yn-1-ol REF: 3D-MTB65928CAS: 1087659-28-6 | Min. 95% | - - - | Discontinued product |

3-(5,6-Dimethoxypyridin-2-yl)prop-2-yn-1-ol
Ref: 10-F615912
1g | Discontinued | Request information |

3-(5,6-Dimethoxypyridin-2-yl)prop-2-yn-1-ol
Ref: 3D-MTB65928
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |