CAS 1087659-31-1

5-Methoxy-3-pyridinecarboxaldehyde oxime

Description:

5-Methoxy-3-pyridinecarboxaldehyde oxime is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a methoxy group (-OCH3) at the 5-position and an oxime functional group (-C=N-OH) derived from the aldehyde at the 3-position contributes to its chemical reactivity and potential applications. This compound is typically a pale yellow to light brown solid or liquid, depending on its purity and specific conditions. It is soluble in organic solvents, which is common for many pyridine derivatives. The oxime functionality can participate in various chemical reactions, including condensation and rearrangement, making it useful in synthetic organic chemistry. Additionally, compounds like this may exhibit biological activity, which can be explored for pharmaceutical applications. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.

Formula: C₇H₈N₂O₂

InChI: InChI=1S/C7H8N2O2/c1-11-7-2-6(4-9-10)3-8-5-7/h2-5,10H,1H3

InChI key: InChIKey=IYJMHCDUUDDZBX-UHFFFAOYSA-N

SMILES: C(=NO)C=1C=C(OC)C=NC1

Synonyms:

• 3-Pyridinecarboxaldehyde, 5-methoxy-, oxime
• 5-Methoxy-3-pyridinecarboxaldehyde oxime