CymitQuimica logo

CAS 1087659-33-3

:

5-Bromo-3-methoxy-2-pyridinecarboxaldehyde oxime

Description:
5-Bromo-3-methoxy-2-pyridinecarboxaldehyde oxime is a chemical compound characterized by its unique functional groups and structural features. It contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, contributing to its basicity and potential for coordination with metal ions. The presence of a bromine atom and a methoxy group on the pyridine ring influences its reactivity and solubility properties. The aldehyde functional group, along with the oxime moiety, suggests that this compound can participate in various chemical reactions, including condensation and nucleophilic addition. The oxime group, derived from the reaction of an aldehyde with hydroxylamine, can also exhibit tautomerism and may be involved in biological activities. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods or referenced from chemical databases.
Formula:C7H7BrN2O2
InChI:InChI=1S/C7H7BrN2O2/c1-12-7-2-5(8)3-9-6(7)4-10-11/h2-4,11H,1H3
InChI key:InChIKey=BMQGIVOUQGZCMY-UHFFFAOYSA-N
SMILES:C(=NO)C1=C(OC)C=C(Br)C=N1
Synonyms:
  • 2-Pyridinecarboxaldehyde, 5-bromo-3-methoxy-, oxime
  • 5-Bromo-3-methoxy-2-pyridinecarboxaldehyde oxime
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.