CAS 108766-35-4
:4-(phenylacetyl)benzoic acid
Description:
4-(Phenylacetyl)benzoic acid, with the CAS number 108766-35-4, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a phenylacetyl group at the para position. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic components. It exhibits acidic properties, as indicated by the presence of the carboxylic acid functional group, which can participate in hydrogen bonding and influence its reactivity and interactions with other molecules. The compound may be utilized in various applications, including pharmaceuticals and organic synthesis, owing to its potential as an intermediate in the production of more complex chemical entities. Additionally, its structural features may impart specific biological activities, making it of interest in medicinal chemistry. Proper handling and storage are essential, as with many organic compounds, to ensure safety and stability.
Formula:C15H12O3
InChI:InChI=1/C15H12O3/c16-14(10-11-4-2-1-3-5-11)12-6-8-13(9-7-12)15(17)18/h1-9H,10H2,(H,17,18)
SMILES:c1ccc(cc1)CC(=O)c1ccc(cc1)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.