CAS 1087730-30-0

Piperidine, 2,3-dimethyl-, hydrochloride (1:1)

Description:

Piperidine, 2,3-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of two methyl groups at the 2 and 3 positions of the piperidine ring contributes to its unique properties, including its potential as a building block in organic synthesis and pharmaceutical applications. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in water. This compound is likely to exhibit basic properties due to the nitrogen atom in the piperidine ring, allowing it to form salts with acids. Its applications may include use in the synthesis of various organic compounds, as well as potential roles in medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₇H₁₅N·ClH

InChI: InChI=1S/C7H15N.ClH/c1-6-4-3-5-8-7(6)2;/h6-8H,3-5H2,1-2H3;1H

InChI key: InChIKey=UECZGGHXYWFHDD-UHFFFAOYSA-N

SMILES: CC1C(C)NCCC1.Cl

Synonyms:

• Piperidine, 2,3-dimethyl-, hydrochloride (1:1)

2,3-Dimethylpiperidine hydrochloride

CAS: 1087730-30-0

2,3-Dimethylpiperidine hydrochloride

Purity: 95%

Molecular weight: 149.67g/mol

Ref: 54-OR1064154

2,3-Dimethylpiperidine hydrochloride

CAS: 1087730-30-0

Versatile small molecule scaffold

Formula: C₇H₁₆ClN

Purity: Min. 95%

Molecular weight: 149.66 g/mol

Ref: 3D-MTB73030