
CAS 108775-12-8
:1H-1,2,4-Triazolo[4,3-a][1,4]diazepine
Description:
1H-1,2,4-Triazolo[4,3-a][1,4]diazepine is a heterocyclic compound characterized by a fused ring system that incorporates both triazole and diazepine moieties. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. Its structure features a five-membered triazole ring fused to a seven-membered diazepine ring, which contributes to its unique chemical properties and potential pharmacological effects. The presence of nitrogen atoms in both rings enhances its ability to form hydrogen bonds, influencing its solubility and reactivity. Additionally, the compound may exhibit various functional groups that can participate in chemical reactions or interactions with biological targets. Due to its structural complexity, 1H-1,2,4-Triazolo[4,3-a][1,4]diazepine can serve as a scaffold for the development of new therapeutic agents, particularly in the fields of neuropharmacology and anti-anxiety treatments. Its specific applications and efficacy would depend on further research and exploration of its interactions within biological systems.
Formula:C6H6N4
InChI:InChI=1S/C6H6N4/c1-2-7-4-6-9-8-5-10(6)3-1/h1-5,9H
InChI key:InChIKey=MIBXSOAJXOSVRS-UHFFFAOYSA-N
SMILES:C1=2N(C=NN1)C=CC=NC2
Synonyms:- 1H-1,2,4-Triazolo[4,3-a][1,4]diazepine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.