CAS 1087784-08-4
:3-Chloro-N-[2-chloro-5-(1-pyrrolidinylsulfonyl)phenyl]propanamide
Description:
3-Chloro-N-[2-chloro-5-(1-pyrrolidinylsulfonyl)phenyl]propanamide is a synthetic organic compound characterized by its complex structure, which includes a propanamide backbone, a chloro substituent, and a sulfonamide moiety linked to a pyrrolidine ring. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to its functional groups. The presence of the chloro groups may enhance its reactivity and influence its pharmacological properties, making it of interest in medicinal chemistry. The sulfonyl group can also contribute to the compound's ability to interact with biological targets, potentially affecting its efficacy and selectivity. As a result, this compound may be investigated for its therapeutic potential, particularly in areas related to inflammation or cancer, where similar structures have shown promise. However, detailed studies on its specific biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its characteristics and applications.
Formula:C13H16Cl2N2O3S
InChI:InChI=1S/C13H16Cl2N2O3S/c14-6-5-13(18)16-12-9-10(3-4-11(12)15)21(19,20)17-7-1-2-8-17/h3-4,9H,1-2,5-8H2,(H,16,18)
InChI key:InChIKey=VFMXOAWGDZGRPW-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC(NC(CCCl)=O)=C(Cl)C=C1)N2CCCC2
Synonyms:- Propanamide, 3-chloro-N-[2-chloro-5-(1-pyrrolidinylsulfonyl)phenyl]-
- 3-Chloro-N-[2-chloro-5-(1-pyrrolidinylsulfonyl)phenyl]propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.