CAS 1087784-20-0
:3-(4-Bromophenyl)-2-(dimethylamino)-3H-thieno[2,3-d]imidazole-5-carboxylic acid
Description:
3-(4-Bromophenyl)-2-(dimethylamino)-3H-thieno[2,3-d]imidazole-5-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a thieno[2,3-d]imidazole core fused with a bromophenyl group and a dimethylamino substituent. This compound typically exhibits properties associated with both aromatic and heteroaromatic systems, such as stability and potential for diverse reactivity. The presence of the carboxylic acid functional group suggests it may exhibit acidic behavior, allowing for potential interactions in biological systems or as a ligand in coordination chemistry. The bromophenyl moiety can enhance lipophilicity and may influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the dimethylamino group can participate in hydrogen bonding and may affect the compound's solubility and reactivity. Overall, this compound's unique structural features position it as a candidate for further investigation in pharmaceutical applications or as a building block in organic synthesis.
Formula:C14H12BrN3O2S
InChI:InChI=1S/C14H12BrN3O2S/c1-17(2)14-16-10-7-11(13(19)20)21-12(10)18(14)9-5-3-8(15)4-6-9/h3-7H,1-2H3,(H,19,20)
InChI key:InChIKey=UMHKWEVMUSNGCY-UHFFFAOYSA-N
SMILES:N(C)(C)C=1N(C2=C(N1)C=C(C(O)=O)S2)C3=CC=C(Br)C=C3
Synonyms:- 3-(4-Bromophenyl)-2-(dimethylamino)-3H-thieno[2,3-d]imidazole-5-carboxylic acid
- 3H-Thieno[2,3-d]imidazole-5-carboxylic acid, 3-(4-bromophenyl)-2-(dimethylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.