CymitQuimica logo

CAS 1087784-22-2

:

3-[5-(3-Bromophenyl)-2-thienyl]-2-propenoic acid

Description:
3-[5-(3-Bromophenyl)-2-thienyl]-2-propenoic acid is an organic compound characterized by its unique structural features, which include a propenoic acid backbone and a thienyl group substituted with a bromophenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic systems, contributing to its potential reactivity and interactions. The presence of the bromine atom enhances the compound's electrophilic character, making it useful in various chemical reactions, including electrophilic aromatic substitution. Additionally, the thienyl group introduces sulfur into the structure, which can influence the compound's electronic properties and solubility. As a propenoic acid derivative, it possesses a carboxylic acid functional group, which can participate in acid-base reactions and form esters or amides. The compound's unique structure may also confer biological activity, making it of interest in medicinal chemistry and materials science. Overall, its distinctive features and potential applications make it a subject of interest in various fields of research.
Formula:C13H9BrO2S
InChI:InChI=1S/C13H9BrO2S/c14-10-3-1-2-9(8-10)12-6-4-11(17-12)5-7-13(15)16/h1-8H,(H,15,16)
InChI key:InChIKey=VPDSDCTZUJEUAD-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C=1SC(=CC1)C2=CC(Br)=CC=C2
Synonyms:
  • 3-[5-(3-Bromophenyl)-2-thienyl]-2-propenoic acid
  • 2-Propenoic acid, 3-[5-(3-bromophenyl)-2-thienyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.