CAS 1087784-23-3

6-Cyclopropyl-2,3-dihydro-1-methyl-3-oxo-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

Description:

6-Cyclopropyl-2,3-dihydro-1-methyl-3-oxo-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a heterocyclic compound characterized by its unique pyrazolo-pyridine structure. This compound features a cyclopropyl group, which contributes to its rigidity and potential biological activity. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The diketone functionality (3-oxo) suggests potential reactivity, allowing for various chemical transformations. This compound may also exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its molecular structure implies potential interactions with biological targets, which could be explored for therapeutic applications. Overall, the combination of its heterocyclic framework and functional groups positions it as a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₁H₁₁N₃O₃

InChI: InChI=1S/C11H11N3O3/c1-14-9-8(10(15)13-14)6(11(16)17)4-7(12-9)5-2-3-5/h4-5H,2-3H2,1H3,(H,13,15)(H,16,17)

InChI key: InChIKey=DJAGYHZCYMBGGO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=NC(=C1)C3CC3)N(C)NC2=O

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 6-cyclopropyl-2,3-dihydro-1-methyl-3-oxo-
• 6-Cyclopropyl-2,3-dihydro-1-methyl-3-oxo-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid