CAS 1087784-26-6

1,1-Dimethylethyl N-[2-[2-(1-pyrrolidinyl)phenyl]ethyl]carbamate

Description:

1,1-Dimethylethyl N-[2-[2-(1-pyrrolidinyl)phenyl]ethyl]carbamate, identified by its CAS number 1087784-26-6, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a dimethyl group attached to a tert-butyl moiety, which contributes to its steric bulk. The presence of a pyrrolidine ring indicates potential for interactions with biological systems, particularly in pharmacological contexts. The compound's functional groups suggest it may exhibit properties such as solubility in organic solvents and potential reactivity with nucleophiles. Its molecular structure implies that it could be involved in various chemical reactions, including hydrolysis and substitution reactions. Additionally, due to its specific functional groups, it may possess biological activity, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications.

Formula: C₁₇H₂₆N₂O₂

InChI: InChI=1S/C17H26N2O2/c1-17(2,3)21-16(20)18-11-10-14-8-4-5-9-15(14)19-12-6-7-13-19/h4-5,8-9H,6-7,10-13H2,1-3H3,(H,18,20)

InChI key: InChIKey=RSGQOSJSZUPUCQ-UHFFFAOYSA-N

SMILES: C(CNC(OC(C)(C)C)=O)C1=C(C=CC=C1)N2CCCC2

Synonyms:

• tert-Butyl N-[2-(2-pyrrolidin-1-ylphenyl)ethyl]carbamate
• 1,1-Dimethylethyl N-[2-[2-(1-pyrrolidinyl)phenyl]ethyl]carbamate
• Carbamic acid, N-[2-[2-(1-pyrrolidinyl)phenyl]ethyl]-, 1,1-dimethylethyl ester