CAS 1087784-33-5

2,3,6,7-Tetrahydro-1,4-dimethyl-3,6-dioxo-1H-pyrazolo[3,4-b]pyridine-5-acetic acid

Description:

2,3,6,7-Tetrahydro-1,4-dimethyl-3,6-dioxo-1H-pyrazolo[3,4-b]pyridine-5-acetic acid is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyridine framework. This compound features multiple functional groups, including two carbonyl (oxo) groups and an acetic acid moiety, contributing to its potential reactivity and biological activity. The presence of the tetrahydro configuration indicates that the compound has a saturated ring system, which may influence its solubility and stability. The dimethyl substitution suggests that it may exhibit specific steric and electronic properties, potentially affecting its interaction with biological targets. While specific applications or biological activities may vary, compounds of this type are often investigated for their pharmacological properties, including anti-inflammatory or antimicrobial effects. The CAS number 1087784-33-5 serves as a unique identifier for this substance, facilitating its recognition in chemical databases and literature. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.

Formula: C₁₀H₁₁N₃O₄

InChI: InChI=1S/C10H11N3O4/c1-4-5(3-6(14)15)9(16)11-8-7(4)10(17)12-13(8)2/h3H2,1-2H3,(H,11,16)(H,12,17)(H,14,15)

InChI key: InChIKey=PVQWSVYOYNRFSJ-UHFFFAOYSA-N

SMILES: CC=1C2=C(NC(=O)C1CC(O)=O)N(C)NC2=O

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-5-acetic acid, 2,3,6,7-tetrahydro-1,4-dimethyl-3,6-dioxo-
• 2,3,6,7-Tetrahydro-1,4-dimethyl-3,6-dioxo-1H-pyrazolo[3,4-b]pyridine-5-acetic acid